ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
164670-44-4 4-Pyridylthiourea |
|
| 상품명칭 | 4-Pyridylthiourea |
| 영문 이름 | 4-Pyridylthiourea;1-pyridin-4-ylthiourea |
| 분자식 | C6H7N3S |
| 분자량 | 153.2049 |
| InChI | InChI=1/C6H7N3S/c7-6(10)9-5-1-3-8-4-2-5/h1-4H,(H3,7,8,9,10) |
| cas번호 | 164670-44-4 |
| 분자 구조 | ![]() |
| 밀도 | 1.382g/cm3 |
| 녹는 점 | 181℃ |
| 비등점 | 298.7°C at 760 mmHg |
| 굴절 지수 | 1.742 |
| 인화점 | 134.4°C |
| 증기압 | 0.00125mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| 보안 규칙 | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |