ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
164670-44-4 4-Pyridylthiourea |
|
| Nama produk | 4-Pyridylthiourea |
| Nama bahasa Inggris | 4-Pyridylthiourea;1-pyridin-4-ylthiourea |
| MF | C6H7N3S |
| Berat Molekul | 153.2049 |
| InChI | InChI=1/C6H7N3S/c7-6(10)9-5-1-3-8-4-2-5/h1-4H,(H3,7,8,9,10) |
| CAS NO | 164670-44-4 |
| Struktur Molekul | ![]() |
| Kepadatan | 1.382g/cm3 |
| Titik lebur | 181℃ |
| Titik didih | 298.7°C at 760 mmHg |
| Indeks bias | 1.742 |
| Titik nyala | 134.4°C |
| Tekanan uap | 0.00125mmHg at 25°C |
| Simbol bahaya | |
| Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Keselamatan Deskripsi | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |