ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
164670-44-4 4-Pyridylthiourea |
|
| Nome do produto | 4-Pyridylthiourea |
| Nome em inglês | 4-Pyridylthiourea;1-pyridin-4-ylthiourea |
| Fórmula molecular | C6H7N3S |
| Peso Molecular | 153.2049 |
| InChI | InChI=1/C6H7N3S/c7-6(10)9-5-1-3-8-4-2-5/h1-4H,(H3,7,8,9,10) |
| CAS Registry Number | 164670-44-4 |
| Estrutura Molecular | ![]() |
| Densidade | 1.382g/cm3 |
| Ponto de fusão | 181℃ |
| Ponto de ebulição | 298.7°C at 760 mmHg |
| índice de refração | 1.742 |
| O ponto de inflamação | 134.4°C |
| Pressão de vapor | 0.00125mmHg at 25°C |
| Símbolos de perigo | |
| Códigos de risco | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Descrição da Segurança | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |