ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
164670-44-4 4-Pyridylthiourea |
|
| termék neve | 4-Pyridylthiourea |
| Angol név | 4-Pyridylthiourea;1-pyridin-4-ylthiourea |
| MF | C6H7N3S |
| Molekulatömeg | 153.2049 |
| InChI | InChI=1/C6H7N3S/c7-6(10)9-5-1-3-8-4-2-5/h1-4H,(H3,7,8,9,10) |
| CAS-szám | 164670-44-4 |
| Molekuláris szerkezete | ![]() |
| Sűrűség | 1.382g/cm3 |
| Olvadáspont | 181℃ |
| Forráspont | 298.7°C at 760 mmHg |
| Törésmutató | 1.742 |
| Gyulladáspont | 134.4°C |
| Gőznyomás | 0.00125mmHg at 25°C |
| Veszély szimbólumok | |
| Kockázatot kódok | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Biztonsági Leírás | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |