ChemIndex - A free chemical CAS databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71799-54-7 Octadecanoic acid, reaction products with tetraethylenepentamine |
|
Chemical Name | Octadecanoic acid, reaction products with tetraethylenepentamine |
Synonyms | Reaction products of stearic acid with tetraethylenepentamine;Tetraethylenepentamine, stearic acid condensate |
Molecular Formula | C18H36O2·C8H23N5 |
Molecular Weight | 473.785 |
InChl | InChI=1/C18H36O2.C8H23N5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;9-1-3-11-5-7-13-8-6-12-4-2-10/h2-17H2,1H3,(H,19,20);11-13H,1-10H2 |
CAS Registry Number | 71799-54-7 |
EINECS | 276-033-1 |
Molecular Structure | ![]() |
MSDS |