ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71799-54-7 옥타데카노산, 테트라에틸렌펜타민과의 반응 생성물 |
|
상품명칭 | 옥타데카노산, 테트라에틸렌펜타민과의 반응 생성물 |
별명 | 스테아르산과 테트라에틸렌펜타민의 반응 생성물; 테트라에틸렌펜타민, 스테아린산 축합물 |
영문 이름 | Octadecanoic acid, reaction products with tetraethylenepentamine;Reaction products of stearic acid with tetraethylenepentamine;Tetraethylenepentamine, stearic acid condensate |
분자식 | C18H36O2·C8H23N5 |
분자량 | 473.785 |
InChI | InChI=1/C18H36O2.C8H23N5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;9-1-3-11-5-7-13-8-6-12-4-2-10/h2-17H2,1H3,(H,19,20);11-13H,1-10H2 |
cas번호 | 71799-54-7 |
EC번호 | 276-033-1 |
분자 구조 | ![]() |
MSDS |