ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71799-54-7 Oktadekanoik asit, tetraetilenpentamin ile reaksiyon ürünleri |
|
Ürün Adı | Oktadekanoik asit, tetraetilenpentamin ile reaksiyon ürünleri |
Eş anlamlı | Stearik asidin tetraetilenpentamin ile reaksiyon ürünleri; Tetraetilenpentamin, stearik asit kondensatı |
ingilizce adı | Octadecanoic acid, reaction products with tetraethylenepentamine;Reaction products of stearic acid with tetraethylenepentamine;Tetraethylenepentamine, stearic acid condensate |
Moleküler Formülü | C18H36O2·C8H23N5 |
Molekül Ağırlığı | 473.785 |
InChI | InChI=1/C18H36O2.C8H23N5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;9-1-3-11-5-7-13-8-6-12-4-2-10/h2-17H2,1H3,(H,19,20);11-13H,1-10H2 |
CAS kayıt numarası | 71799-54-7 |
EINECS | 276-033-1 |
Moleküler Yapısı | ![]() |
MSDS |