ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71799-54-7 Asid octadecanoic, produk tindak balas dengan tetraethylenepentamine |
|
Nama produk | Asid octadecanoic, produk tindak balas dengan tetraethylenepentamine |
Sinonim | Produk tindak balas asid stearik dengan tetraethylenepentamine; Tetraethylenepentamine, kondensat asid stearik |
Nama Inggeris | Octadecanoic acid, reaction products with tetraethylenepentamine;Reaction products of stearic acid with tetraethylenepentamine;Tetraethylenepentamine, stearic acid condensate |
MF | C18H36O2·C8H23N5 |
Berat Molekul | 473.785 |
InChI | InChI=1/C18H36O2.C8H23N5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;9-1-3-11-5-7-13-8-6-12-4-2-10/h2-17H2,1H3,(H,19,20);11-13H,1-10H2 |
CAS NO | 71799-54-7 |
EINECS | 276-033-1 |
Struktur Molekul | ![]() |
MSDS |