ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
71799-54-7 Oktadecanosyre, reaksjonsprodukter med tetraetylenpentamin |
|
produktnavn | Oktadecanosyre, reaksjonsprodukter med tetraetylenpentamin |
Synonymer | Reaksjonsprodukter av stearinsyre med tetraetylenpentamin; Tetraetylenpentamin, stearinsyrekondensat |
Engelsk navn | Octadecanoic acid, reaction products with tetraethylenepentamine;Reaction products of stearic acid with tetraethylenepentamine;Tetraethylenepentamine, stearic acid condensate |
Molekylær Formel | C18H36O2·C8H23N5 |
Molekylvekt | 473.785 |
InChI | InChI=1/C18H36O2.C8H23N5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;9-1-3-11-5-7-13-8-6-12-4-2-10/h2-17H2,1H3,(H,19,20);11-13H,1-10H2 |
CAS-nummer | 71799-54-7 |
EINECS | 276-033-1 |
Molecular Structure | ![]() |
MSDS |