ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
114152-19-1 2,3,6-trifluorobenzyl alcohol |
|
Produkt-Name | 2,3,6-trifluorobenzyl alcohol |
Englischer Name | 2,3,6-trifluorobenzyl alcohol; |
Molekulare Formel | C7H5F3O |
Molecular Weight | 162.1092 |
InChl | InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
CAS Registry Number | 114152-19-1 |
Molecular Structure | ![]() |
Dichte | 1.398g/cm3 |
Schmelzpunkt | 43-45℃ |
Siedepunkt | 187°C at 760 mmHg |
Brechungsindex | 1.476 |
Flammpunkt | 80.8°C |
Dampfdruck | 0.412mmHg at 25°C |
Risk Codes | R36/38##Irritating to eyes and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |