ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
114152-19-1 2,3,6-trifluorobenzyl alcohol |
|
نام محصول | 2,3,6-trifluorobenzyl alcohol |
نام انگلیسی | 2,3,6-trifluorobenzyl alcohol; |
میدان مغناطیسی | C7H5F3O |
وزن مولکولی | 162.1092 |
InChI | InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
شماره سیایاس | 114152-19-1 |
ساختار مولکولی | ![]() |
تراکم | 1.398g/cm3 |
نقطه ذوب | 43-45℃ |
نقطه غلیان | 187°C at 760 mmHg |
ضریب شکست | 1.476 |
نقطه اشتعال | 80.8°C |
فشار بخار | 0.412mmHg at 25°C |
کدهای خطر | R36/38##Irritating to eyes and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |