ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
114152-19-1 2,3,6-trifluorobenzyl alcohol |
|
상품명칭 | 2,3,6-trifluorobenzyl alcohol |
영문 이름 | 2,3,6-trifluorobenzyl alcohol; |
분자식 | C7H5F3O |
분자량 | 162.1092 |
InChI | InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
cas번호 | 114152-19-1 |
분자 구조 | ![]() |
밀도 | 1.398g/cm3 |
녹는 점 | 43-45℃ |
비등점 | 187°C at 760 mmHg |
굴절 지수 | 1.476 |
인화점 | 80.8°C |
증기압 | 0.412mmHg at 25°C |
리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |