Chemindex > 114152-19-1
KR ▼
114152-19-1 2,3,6-trifluorobenzyl alcohol |
|
| 상품명칭 | 2,3,6-trifluorobenzyl alcohol |
| 영문 이름 | 2,3,6-trifluorobenzyl alcohol; |
| 분자식 | C7H5F3O |
| 분자량 | 162.1092 |
| InChI | InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
| cas번호 | 114152-19-1 |
| 분자 구조 |  |
| 밀도 | 1.398g/cm3 |
| 녹는 점 | 43-45℃ |
| 비등점 | 187°C at 760 mmHg |
| 굴절 지수 | 1.476 |
| 인화점 | 80.8°C |
| 증기압 | 0.412mmHg at 25°C |
| 리스크 규칙 | R36/38##Irritating to eyes and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 