ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
114152-19-1 2,3,6-trifluorobenzyl alcohol |
|
اسم المنتج | 2,3,6-trifluorobenzyl alcohol |
الاسم بالانجليزية | 2,3,6-trifluorobenzyl alcohol; |
الصيغة الجزيئية | C7H5F3O |
الوزن الجزيئي الغرامي | 162.1092 |
InChI | InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
إستراتيجية المساعدة القطرية | 114152-19-1 |
بنية جزيئية | ![]() |
كثافة | 1.398g/cm3 |
درجة الإنصهار | 43-45℃ |
نقطة الغليان | 187°C at 760 mmHg |
معامل الإنكسار | 1.476 |
نقطة الوميض | 80.8°C |
ضغط البخار | 0.412mmHg at 25°C |
خطر المصطلحات | R36/38##Irritating to eyes and skin.:; |
شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |