ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
114152-19-1 2,3,6-trifluorobenzyl alcohol |
|
Ürün Adı | 2,3,6-trifluorobenzyl alcohol |
ingilizce adı | 2,3,6-trifluorobenzyl alcohol; |
Moleküler Formülü | C7H5F3O |
Molekül Ağırlığı | 162.1092 |
InChI | InChI=1/C7H5F3O/c8-5-1-2-6(9)7(10)4(5)3-11/h1-2,11H,3H2 |
CAS kayıt numarası | 114152-19-1 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.398g/cm3 |
Ergime noktası | 43-45℃ |
Kaynama noktası | 187°C at 760 mmHg |
Kırılma indisi | 1.476 |
Alevlenme noktası | 80.8°C |
Buhar basıncı | 0.412mmHg at 25°C |
Risk Kodları | R36/38##Irritating to eyes and skin.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |