ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175204-41-8 3-(2-Chlor-6-fluorphenyl)-5-methylisoxazol-4-carbonitril |
|
Produkt-Name | 3-(2-Chlor-6-fluorphenyl)-5-methylisoxazol-4-carbonitril |
Synonyme | 3-(2-Chlor-6-fluorphenyl)-5-methylisoxazol-4-carbothioamid; |
Englischer Name | 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile;3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbothioamide |
Molekulare Formel | C11H8ClFN2OS |
Molecular Weight | 270.7104 |
InChl | InChI=1/C11H8ClFN2OS/c1-5-8(11(14)17)10(15-16-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3,(H2,14,17) |
CAS Registry Number | 175204-41-8 |
Molecular Structure | ![]() |
Dichte | 1.426g/cm3 |
Schmelzpunkt | 85℃ |
Siedepunkt | 408.4°C at 760 mmHg |
Brechungsindex | 1.625 |
Flammpunkt | 200.8°C |
Dampfdruck | 7.01E-07mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Safety Beschreibung | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |