ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
175204-41-8 3- (2-chloro-6-fluorophenyl) -5-methylisoxazole-4-carbonitrile؛ 3- (2-chloro-6-fluorophenyl) -5-methylisoxazole-4-carbothioamide؛ |
|
نام محصول | 3- (2-chloro-6-fluorophenyl) -5-methylisoxazole-4-carbonitrile؛ 3- (2-chloro-6-fluorophenyl) -5-methylisoxazole-4-carbothioamide؛ |
نام انگلیسی | 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile;3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbothioamide |
میدان مغناطیسی | C11H8ClFN2OS |
وزن مولکولی | 270.7104 |
InChI | InChI=1/C11H8ClFN2OS/c1-5-8(11(14)17)10(15-16-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3,(H2,14,17) |
شماره سیایاس | 175204-41-8 |
ساختار مولکولی | ![]() |
تراکم | 1.426g/cm3 |
نقطه ذوب | 85℃ |
نقطه غلیان | 408.4°C at 760 mmHg |
ضریب شکست | 1.625 |
نقطه اشتعال | 200.8°C |
فشار بخار | 7.01E-07mmHg at 25°C |
خطر نمادها | |
کدهای خطر | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
توضیحات ایمنی | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |