Chemindex > 175204-41-8
ID ▼
175204-41-8 3- (2-kloro-6-fluorofenil) -5-methylisoxazole-4-carbonitrile |
|
| Nama produk | 3- (2-kloro-6-fluorofenil) -5-methylisoxazole-4-carbonitrile |
| Sinonim | 3- (2-kloro-6-fluorofenil) -5-methylisoxazole-4-carbothioamide; |
| Nama bahasa Inggris | 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile;3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbothioamide |
| MF | C11H8ClFN2OS |
| Berat Molekul | 270.7104 |
| InChI | InChI=1/C11H8ClFN2OS/c1-5-8(11(14)17)10(15-16-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3,(H2,14,17) |
| CAS NO | 175204-41-8 |
| Struktur Molekul |  |
| Kepadatan | 1.426g/cm3 |
| Titik lebur | 85℃ |
| Titik didih | 408.4°C at 760 mmHg |
| Indeks bias | 1.625 |
| Titik nyala | 200.8°C |
| Tekanan uap | 7.01E-07mmHg at 25°C |
| Simbol bahaya |  Xn##Harmful:; |
| Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Keselamatan Deskripsi | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Pemasok seharga 175204-41-8 (0):
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 