Chemindex > 175204-41-8
NO ▼
175204-41-8 3-(2-klor-6-fluorfenyl)-5-metylisoksazol-4-karbonitril |
|
| produktnavn | 3-(2-klor-6-fluorfenyl)-5-metylisoksazol-4-karbonitril |
| Synonymer | 3-(2-klor-6-fluorfenyl)-5-metylisoksazol-4-karbothioamid; |
| Engelsk navn | 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile;3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbothioamide |
| Molekylær Formel | C11H8ClFN2OS |
| Molekylvekt | 270.7104 |
| InChI | InChI=1/C11H8ClFN2OS/c1-5-8(11(14)17)10(15-16-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3,(H2,14,17) |
| CAS-nummer | 175204-41-8 |
| Molecular Structure |  |
| Tetthet | 1.426g/cm3 |
| Smeltepunkt | 85℃ |
| Kokepunkt | 408.4°C at 760 mmHg |
| Brytningsindeks | 1.625 |
| Flammepunktet | 200.8°C |
| Damptrykk | 7.01E-07mmHg at 25°C |
| Hazard symboler |  Xn##Harmful:; |
| Risiko Koder | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Sikkerhet Beskrivelse | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Leverandører for 175204-41-8 (0):
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 