Chemindex >175204-41-8
MY ▼
175204-41-8 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile |
|
| Nama produk | 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile |
| Sinonim | 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbothioamide; |
| Nama Inggeris | 3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbonitrile;3-(2-chloro-6-fluorophenyl)-5-methylisoxazole-4-carbothioamide |
| MF | C11H8ClFN2OS |
| Berat Molekul | 270.7104 |
| InChI | InChI=1/C11H8ClFN2OS/c1-5-8(11(14)17)10(15-16-5)9-6(12)3-2-4-7(9)13/h2-4H,1H3,(H2,14,17) |
| CAS NO | 175204-41-8 |
| Struktur Molekul |  |
| Kepadatan | 1.426g/cm3 |
| Titik lebur | 85℃ |
| Titik didih | 408.4°C at 760 mmHg |
| Indeks bias | 1.625 |
| Titik nyala | 200.8°C |
| Tekanan wap | 7.01E-07mmHg at 25°C |
| Cinta bahaya |  Xn##Harmful:; |
| Kod Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
| Keselamatan Penerangan | S36/37##Wear suitable protective clothing and gloves.:; |
| MSDS | |
- Jika anda bercadang untuk mendapatkan bahan kimia dari China, pergi sahaja ke pusat membeli-belah ChemNet, kami akan mendapatkan harga terkini dan kompetitif daripada pengeluar China untuk anda.Sila lawati
ChemNet Mall
Pembekal untuk 175204-41-8 (0):
Perkhidmatan Pangkalan Data CAS Kimia disediakan oleh ChemIndex.com 