ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
208173-22-2 2,3,6-trifluoroacetophenone |
|
| Produkt-Name | 2,3,6-trifluoroacetophenone |
| Englischer Name | 2,3,6-trifluoroacetophenone;2',3',6'-trifluoroacetophenone;1-(2,3,6-trifluorophenyl)ethanone |
| Molekulare Formel | C8H5F3O |
| Molecular Weight | 174.1199 |
| InChl | InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
| CAS Registry Number | 208173-22-2 |
| Molecular Structure | ![]() |
| Dichte | 1.303g/cm3 |
| Siedepunkt | 187.2°C at 760 mmHg |
| Brechungsindex | 1.455 |
| Flammpunkt | 65°C |
| Dampfdruck | 0.637mmHg at 25°C |
| Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |