ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
208173-22-2 2,3,6-trifluoroacetophenone |
|
| Naam product | 2,3,6-trifluoroacetophenone |
| Engelse naam | 2,3,6-trifluoroacetophenone;2',3',6'-trifluoroacetophenone;1-(2,3,6-trifluorophenyl)ethanone |
| MF | C8H5F3O |
| Molecuulgewicht | 174.1199 |
| InChI | InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
| CAS-nummer | 208173-22-2 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1.303g/cm3 |
| Kookpunt | 187.2°C at 760 mmHg |
| Brekingsindex | 1.455 |
| Vlampunt | 65°C |
| Dampdruk | 0.637mmHg at 25°C |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |