ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
208173-22-2 2,3,6-trifluoroacetophenone |
|
| Nome do produto | 2,3,6-trifluoroacetophenone |
| Nome em inglês | 2,3,6-trifluoroacetophenone;2',3',6'-trifluoroacetophenone;1-(2,3,6-trifluorophenyl)ethanone |
| Fórmula molecular | C8H5F3O |
| Peso Molecular | 174.1199 |
| InChI | InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
| CAS Registry Number | 208173-22-2 |
| Estrutura Molecular | ![]() |
| Densidade | 1.303g/cm3 |
| Ponto de ebulição | 187.2°C at 760 mmHg |
| índice de refração | 1.455 |
| O ponto de inflamação | 65°C |
| Pressão de vapor | 0.637mmHg at 25°C |
| Códigos de risco | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |