ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
208173-22-2 2,3,6-trifluoroacetophenone |
|
| نام محصول | 2,3,6-trifluoroacetophenone |
| نام انگلیسی | 2,3,6-trifluoroacetophenone;2',3',6'-trifluoroacetophenone;1-(2,3,6-trifluorophenyl)ethanone |
| میدان مغناطیسی | C8H5F3O |
| وزن مولکولی | 174.1199 |
| InChI | InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
| شماره سیایاس | 208173-22-2 |
| ساختار مولکولی | ![]() |
| تراکم | 1.303g/cm3 |
| نقطه غلیان | 187.2°C at 760 mmHg |
| ضریب شکست | 1.455 |
| نقطه اشتعال | 65°C |
| فشار بخار | 0.637mmHg at 25°C |
| کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |