ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
208173-22-2 2,3,6-trifluoroacetophenone |
|
| उत्पाद का नाम | 2,3,6-trifluoroacetophenone |
| अंग्रेज | 2,3,6-trifluoroacetophenone;2',3',6'-trifluoroacetophenone;1-(2,3,6-trifluorophenyl)ethanone |
| आणविक फार्मूला | C8H5F3O |
| आण्विक वजन | 174.1199 |
| InChI | InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
| कैस रजिस्टी संख्या | 208173-22-2 |
| आणविक संरचना | ![]() |
| घनत्व | 1.303g/cm3 |
| उबलने का समय | 187.2°C at 760 mmHg |
| अपवर्तक सूचकांक | 1.455 |
| फ्लैश प्वाइंट | 65°C |
| वाष्प का दबाव | 0.637mmHg at 25°C |
| खतरे के कोड | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |