ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-57-6 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester |
|
| Produkt-Name | 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester |
| Englischer Name | 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester;2-(3,5-Difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| Molekulare Formel | C11H13BF2O2 |
| Molecular Weight | 226.0275 |
| InChl | InChI=1/C11H13BF2O2/c1-11(2)6-15-12(16-7-11)8-3-9(13)5-10(14)4-8/h3-5H,6-7H2,1-2H3 |
| CAS Registry Number | 216393-57-6 |
| Molecular Structure | ![]() |
| Dichte | 1.14g/cm3 |
| Siedepunkt | 290.9°C at 760 mmHg |
| Brechungsindex | 1.468 |
| Flammpunkt | 129.8°C |
| Dampfdruck | 0.0035mmHg at 25°C |
| Safety Beschreibung | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |