ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-57-6 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester |
|
| نام محصول | 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester |
| نام انگلیسی | 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester;2-(3,5-Difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| میدان مغناطیسی | C11H13BF2O2 |
| وزن مولکولی | 226.0275 |
| InChI | InChI=1/C11H13BF2O2/c1-11(2)6-15-12(16-7-11)8-3-9(13)5-10(14)4-8/h3-5H,6-7H2,1-2H3 |
| شماره سیایاس | 216393-57-6 |
| ساختار مولکولی | ![]() |
| تراکم | 1.14g/cm3 |
| نقطه غلیان | 290.9°C at 760 mmHg |
| ضریب شکست | 1.468 |
| نقطه اشتعال | 129.8°C |
| فشار بخار | 0.0035mmHg at 25°C |
| توضیحات ایمنی | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |