Chemindex > 216393-57-6
NL â–¼
216393-57-6 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester |
|
| Naam product | 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester |
| Engelse naam | 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester;2-(3,5-Difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| MF | C11H13BF2O2 |
| Molecuulgewicht | 226.0275 |
| InChI | InChI=1/C11H13BF2O2/c1-11(2)6-15-12(16-7-11)8-3-9(13)5-10(14)4-8/h3-5H,6-7H2,1-2H3 |
| CAS-nummer | 216393-57-6 |
| Moleculaire Structuur |  |
| Dichtheid | 1.14g/cm3 |
| Kookpunt | 290.9°C at 760 mmHg |
| Brekingsindex | 1.468 |
| Vlampunt | 129.8°C |
| Dampdruk | 0.0035mmHg at 25°C |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 216393-57-6 (0):
Chemical CAS Database Service wordt geleverd door ChemIndex.com 