ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216393-57-6 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester |
|
| Ürün Adı | 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester |
| ingilizce adı | 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester;2-(3,5-Difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| Moleküler Formülü | C11H13BF2O2 |
| Molekül Ağırlığı | 226.0275 |
| InChI | InChI=1/C11H13BF2O2/c1-11(2)6-15-12(16-7-11)8-3-9(13)5-10(14)4-8/h3-5H,6-7H2,1-2H3 |
| CAS kayıt numarası | 216393-57-6 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.14g/cm3 |
| Kaynama noktası | 290.9°C at 760 mmHg |
| Kırılma indisi | 1.468 |
| Alevlenme noktası | 129.8°C |
| Buhar basıncı | 0.0035mmHg at 25°C |
| Güvenlik Açıklaması | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |