Chemindex > 216393-57-6
KR ▼
216393-57-6 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester |
|
| 상품명칭 | 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester |
| 영문 이름 | 3,5-Difluorobenzeneboronic acid neopentyl glycol cyclic ester;2-(3,5-Difluorophenyl)-5,5-dimethyl-1,3,2-dioxaborinane |
| 분자식 | C11H13BF2O2 |
| 분자량 | 226.0275 |
| InChI | InChI=1/C11H13BF2O2/c1-11(2)6-15-12(16-7-11)8-3-9(13)5-10(14)4-8/h3-5H,6-7H2,1-2H3 |
| cas번호 | 216393-57-6 |
| 분자 구조 |  |
| 밀도 | 1.14g/cm3 |
| 비등점 | 290.9°C at 760 mmHg |
| 굴절 지수 | 1.468 |
| 인화점 | 129.8°C |
| 증기압 | 0.0035mmHg at 25°C |
| 보안 규칙 | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- 중국에서 화학 물질을 공급할 계획이라면 ChemNet 쇼핑몰로 이동하면 중국 제조업체로부터 최신의 경쟁력있는 가격을 얻을 수 있습니다.방문하십시오
ChemNet Mall
216393-57-6 (0) 공급 업체:
Chemical CAS Database Service는 ChemIndex.com 에서 제공합니다. 