ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
226396-32-3 2,3,4-Trifluorophenylboronic acid |
|
Produkt-Name | 2,3,4-Trifluorophenylboronic acid |
Englischer Name | 2,3,4-Trifluorophenylboronic acid; |
Molekulare Formel | C6H4BF3O2 |
Molecular Weight | 175.901 |
InChl | InChI=1/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
CAS Registry Number | 226396-32-3 |
Molecular Structure | ![]() |
Dichte | 1.44g/cm3 |
Schmelzpunkt | 229-235℃ |
Siedepunkt | 260.2°C at 760 mmHg |
Brechungsindex | 1.465 |
Flammpunkt | 111.2°C |
Dampfdruck | 0.00629mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |