ChemIndex - یک پایگاه داده CAS شیمیایی رایگانToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
226396-32-3 2,3,4-Trifluorophenylboronic acid |
|
نام محصول | 2,3,4-Trifluorophenylboronic acid |
نام انگلیسی | 2,3,4-Trifluorophenylboronic acid; |
میدان مغناطیسی | C6H4BF3O2 |
وزن مولکولی | 175.901 |
InChI | InChI=1/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
شماره سیایاس | 226396-32-3 |
ساختار مولکولی | ![]() |
تراکم | 1.44g/cm3 |
نقطه ذوب | 229-235℃ |
نقطه غلیان | 260.2°C at 760 mmHg |
ضریب شکست | 1.465 |
نقطه اشتعال | 111.2°C |
فشار بخار | 0.00629mmHg at 25°C |
کدهای خطر | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
توضیحات ایمنی | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |