ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
226396-32-3 2,3,4-Trifluorophenylboronic acid |
|
| Ürün Adı | 2,3,4-Trifluorophenylboronic acid |
| ingilizce adı | 2,3,4-Trifluorophenylboronic acid; |
| Moleküler Formülü | C6H4BF3O2 |
| Molekül Ağırlığı | 175.901 |
| InChI | InChI=1/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
| CAS kayıt numarası | 226396-32-3 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.44g/cm3 |
| Ergime noktası | 229-235℃ |
| Kaynama noktası | 260.2°C at 760 mmHg |
| Kırılma indisi | 1.465 |
| Alevlenme noktası | 111.2°C |
| Buhar basıncı | 0.00629mmHg at 25°C |
| Risk Kodları | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |