ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
226396-32-3 2,3,4-Trifluorophenylboronic acid |
|
| produktnavn | 2,3,4-Trifluorophenylboronic acid |
| Engelsk navn | 2,3,4-Trifluorophenylboronic acid; |
| Molekylær Formel | C6H4BF3O2 |
| Molekylvekt | 175.901 |
| InChI | InChI=1/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
| CAS-nummer | 226396-32-3 |
| Molecular Structure | ![]() |
| Tetthet | 1.44g/cm3 |
| Smeltepunkt | 229-235℃ |
| Kokepunkt | 260.2°C at 760 mmHg |
| Brytningsindeks | 1.465 |
| Flammepunktet | 111.2°C |
| Damptrykk | 0.00629mmHg at 25°C |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |