ChemIndex - Μια ελεύθερη χημική βάση δεδομένων CASToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
226396-32-3 2,3,4-Trifluorophenylboronic acid |
|
Ονομασία του προϊόντος | 2,3,4-Trifluorophenylboronic acid |
Αγγλικό όνομα | 2,3,4-Trifluorophenylboronic acid; |
MF | C6H4BF3O2 |
Μοριακό βάρος | 175.901 |
InChI | InChI=1/C6H4BF3O2/c8-4-2-1-3(7(11)12)5(9)6(4)10/h1-2,11-12H |
CAS ΟΧΙ | 226396-32-3 |
Μοριακή δομή | ![]() |
Πυκνότητα | 1.44g/cm3 |
Σημείο τήξης | 229-235℃ |
Σημείο βρασμού | 260.2°C at 760 mmHg |
Δείκτης διάθλασης | 1.465 |
Σημείο ανάφλεξης | 111.2°C |
Πίεση ατμών | 0.00629mmHg at 25°C |
Κινδύνου Κώδικες | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Περιγραφή της ασφάλειας | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |