ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
263157-86-4 2-(2,6-Dichlorbenzyl)-1,3-thiazol-4-carbonylchlorid |
|
Produkt-Name | 2-(2,6-Dichlorbenzyl)-1,3-thiazol-4-carbonylchlorid |
Englischer Name | 2-(2,6-dichlorobenzyl)-1,3-thiazole-4-carbonyl chloride; |
Molekulare Formel | C11H6Cl3NOS |
Molecular Weight | 306.5954 |
InChl | InChI=1/C11H6Cl3NOS/c12-7-2-1-3-8(13)6(7)4-10-15-9(5-17-10)11(14)16/h1-3,5H,4H2 |
CAS Registry Number | 263157-86-4 |
Molecular Structure | ![]() |
Dichte | 1.518g/cm3 |
Schmelzpunkt | 100℃ |
Siedepunkt | 422°C at 760 mmHg |
Brechungsindex | 1.632 |
Flammpunkt | 209°C |
Dampfdruck | 2.5E-07mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R34##Causes burns.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |