ChemIndex - एक मुक्त रासायनिक सीएएस डेटाबेToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
263157-86-4 2- (2,6-डाइक्लोरोबेंज़िल) -1,3-थियाज़ोल -4-कार्बोनिल क्लोराइड |
|
उत्पाद का नाम | 2- (2,6-डाइक्लोरोबेंज़िल) -1,3-थियाज़ोल -4-कार्बोनिल क्लोराइड |
अंग्रेज | 2-(2,6-dichlorobenzyl)-1,3-thiazole-4-carbonyl chloride; |
आणविक फार्मूला | C11H6Cl3NOS |
आण्विक वजन | 306.5954 |
InChI | InChI=1/C11H6Cl3NOS/c12-7-2-1-3-8(13)6(7)4-10-15-9(5-17-10)11(14)16/h1-3,5H,4H2 |
कैस रजिस्टी संख्या | 263157-86-4 |
आणविक संरचना | ![]() |
घनत्व | 1.518g/cm3 |
गलनांक | 100℃ |
उबलने का समय | 422°C at 760 mmHg |
अपवर्तक सूचकांक | 1.632 |
फ्लैश प्वाइंट | 209°C |
वाष्प का दबाव | 2.5E-07mmHg at 25°C |
खतरा प्रतीक | |
खतरे के कोड | R34##Causes burns.:; |
सुरक्षा विवरण | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |