ChemIndex - Pangkalan data CAS kimia percumaToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
263157-86-4 2-(2,6-dichlorobenzyl)-1,3-thiazole-4-karbonil klorida |
|
Nama produk | 2-(2,6-dichlorobenzyl)-1,3-thiazole-4-karbonil klorida |
Nama Inggeris | 2-(2,6-dichlorobenzyl)-1,3-thiazole-4-carbonyl chloride; |
MF | C11H6Cl3NOS |
Berat Molekul | 306.5954 |
InChI | InChI=1/C11H6Cl3NOS/c12-7-2-1-3-8(13)6(7)4-10-15-9(5-17-10)11(14)16/h1-3,5H,4H2 |
CAS NO | 263157-86-4 |
Struktur Molekul | ![]() |
Kepadatan | 1.518g/cm3 |
Titik lebur | 100℃ |
Titik didih | 422°C at 760 mmHg |
Indeks bias | 1.632 |
Titik nyala | 209°C |
Tekanan wap | 2.5E-07mmHg at 25°C |
Cinta bahaya | |
Kod Risiko | R34##Causes burns.:; |
Keselamatan Penerangan | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |