ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
263157-86-4 2- (2,6-diklorobenzil) -1,3-tiyazol-4-karbonil klorür |
|
Ürün Adı | 2- (2,6-diklorobenzil) -1,3-tiyazol-4-karbonil klorür |
Eş anlamlı | |
ingilizce adı | 2-(2,6-dichlorobenzyl)-1,3-thiazole-4-carbonyl chloride; |
Moleküler Formülü | C11H6Cl3NOS |
Molekül Ağırlığı | 306.5954 |
InChI | InChI=1/C11H6Cl3NOS/c12-7-2-1-3-8(13)6(7)4-10-15-9(5-17-10)11(14)16/h1-3,5H,4H2 |
CAS kayıt numarası | 263157-86-4 |
Moleküler Yapısı | ![]() |
Yoğunluk | 1.518g/cm3 |
Ergime noktası | 100℃ |
Kaynama noktası | 422°C at 760 mmHg |
Kırılma indisi | 1.632 |
Alevlenme noktası | 209°C |
Buhar basıncı | 2.5E-07mmHg at 25°C |
Tehlike Sembolleri | |
Risk Kodları | R34##Causes burns.:; |
Güvenlik Açıklaması | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |