ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
263157-86-4 chlorek 2-(2,6-dichlorobenzylo)-1,3-tiazola-4-karbonylu |
|
Nazwa produktu: | chlorek 2-(2,6-dichlorobenzylo)-1,3-tiazola-4-karbonylu |
Angielska nazwa | 2-(2,6-dichlorobenzyl)-1,3-thiazole-4-carbonyl chloride; |
MF | C11H6Cl3NOS |
Masie cząsteczkowej | 306.5954 |
InChI | InChI=1/C11H6Cl3NOS/c12-7-2-1-3-8(13)6(7)4-10-15-9(5-17-10)11(14)16/h1-3,5H,4H2 |
Nr CAS | 263157-86-4 |
Struktury molekularnej | ![]() |
Gęstość | 1.518g/cm3 |
Temperatura topnienia | 100℃ |
Temperatura wrzenia | 422°C at 760 mmHg |
Współczynnik załamania | 1.632 |
Temperatura zapłonu | 209°C |
Ciśnienie pary | 2.5E-07mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |