ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 342405-32-7 5-bromo-2,3,4-trimethylbenzoyl chloride | |
| Produkt-Name | 5-bromo-2,3,4-trimethylbenzoyl chloride | 
| Englischer Name | 5-bromo-2,3,4-trimethylbenzoyl chloride; | 
| Molekulare Formel | C10H10BrClO | 
| Molecular Weight | 261.5428 | 
| InChl | InChI=1/C10H10BrClO/c1-5-6(2)8(10(12)13)4-9(11)7(5)3/h4H,1-3H3 | 
| CAS Registry Number | 342405-32-7 | 
| Molecular Structure |  | 
| Dichte | 1.446g/cm3 | 
| Schmelzpunkt | 60.1℃ | 
| Siedepunkt | 332.5°C at 760 mmHg | 
| Brechungsindex | 1.562 | 
| Flammpunkt | 154.9°C | 
| Dampfdruck | 0.000145mmHg at 25°C | 
| Gefahrensymbole | |
| Risk Codes | R34##Causes burns.:; | 
| Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
| MSDS | |