ChemIndex - Ingyenes kémiai CAS adatbázisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 342405-32-7 5-bromo-2,3,4-trimethylbenzoyl chloride | |
| termék neve | 5-bromo-2,3,4-trimethylbenzoyl chloride | 
| Angol név | 5-bromo-2,3,4-trimethylbenzoyl chloride; | 
| MF | C10H10BrClO | 
| Molekulatömeg | 261.5428 | 
| InChI | InChI=1/C10H10BrClO/c1-5-6(2)8(10(12)13)4-9(11)7(5)3/h4H,1-3H3 | 
| CAS-szám | 342405-32-7 | 
| Molekuláris szerkezete |  | 
| Sűrűség | 1.446g/cm3 | 
| Olvadáspont | 60.1℃ | 
| Forráspont | 332.5°C at 760 mmHg | 
| Törésmutató | 1.562 | 
| Gyulladáspont | 154.9°C | 
| Gőznyomás | 0.000145mmHg at 25°C | 
| Veszély szimbólumok | |
| Kockázatot kódok | R34##Causes burns.:; | 
| Biztonsági Leírás | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
| MSDS | |