ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 342405-32-7 5-bromo-2,3,4-trimethylbenzoyl chloride | |
| Nome do produto | 5-bromo-2,3,4-trimethylbenzoyl chloride | 
| Nome em inglês | 5-bromo-2,3,4-trimethylbenzoyl chloride; | 
| Fórmula molecular | C10H10BrClO | 
| Peso Molecular | 261.5428 | 
| InChI | InChI=1/C10H10BrClO/c1-5-6(2)8(10(12)13)4-9(11)7(5)3/h4H,1-3H3 | 
| CAS Registry Number | 342405-32-7 | 
| Estrutura Molecular |  | 
| Densidade | 1.446g/cm3 | 
| Ponto de fusão | 60.1℃ | 
| Ponto de ebulição | 332.5°C at 760 mmHg | 
| índice de refração | 1.562 | 
| O ponto de inflamação | 154.9°C | 
| Pressão de vapor | 0.000145mmHg at 25°C | 
| Símbolos de perigo | |
| Códigos de risco | R34##Causes burns.:; | 
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
| MSDS | |