ChemIndex - Un database CAS chimico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 342405-32-7 5-bromo-2,3,4-trimethylbenzoyl chloride | |
| Nome del prodotto | 5-bromo-2,3,4-trimethylbenzoyl chloride | 
| Nome inglese | 5-bromo-2,3,4-trimethylbenzoyl chloride; | 
| Formula molecolare | C10H10BrClO | 
| Peso Molecolare | 261.5428 | 
| InChI | InChI=1/C10H10BrClO/c1-5-6(2)8(10(12)13)4-9(11)7(5)3/h4H,1-3H3 | 
| Numero CAS | 342405-32-7 | 
| Struttura molecolare |  | 
| Densità | 1.446g/cm3 | 
| Punto di fusione | 60.1℃ | 
| Punto di ebollizione | 332.5°C at 760 mmHg | 
| Indice di rifrazione | 1.562 | 
| Punto d'infiammabilità | 154.9°C | 
| Pressione di vapore | 0.000145mmHg at 25°C | 
| Simboli di pericolo | |
| Codici di Rischio | R34##Causes burns.:; | 
| Sicurezza Descrizione | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
| MSDS | |