ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 342405-32-7 5-bromo-2,3,4-trimethylbenzoyl chloride | |
| produktnavn | 5-bromo-2,3,4-trimethylbenzoyl chloride | 
| Engelsk navn | 5-bromo-2,3,4-trimethylbenzoyl chloride; | 
| Molekylær Formel | C10H10BrClO | 
| Molekylvekt | 261.5428 | 
| InChI | InChI=1/C10H10BrClO/c1-5-6(2)8(10(12)13)4-9(11)7(5)3/h4H,1-3H3 | 
| CAS-nummer | 342405-32-7 | 
| Molecular Structure |  | 
| Tetthet | 1.446g/cm3 | 
| Smeltepunkt | 60.1℃ | 
| Kokepunkt | 332.5°C at 760 mmHg | 
| Brytningsindeks | 1.562 | 
| Flammepunktet | 154.9°C | 
| Damptrykk | 0.000145mmHg at 25°C | 
| Hazard symboler | |
| Risiko Koder | R34##Causes burns.:; | 
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; | 
| MSDS | |