ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
365-12-8 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid |
|
Produkt-Name | 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid |
Englischer Name | 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid;2-Fluorobiphenyl-4-carboxylic acid;bis(4-fluorophenyl)methanol;2'-fluorobiphenyl-4-carboxylate |
Molekulare Formel | C13H8FO2 |
Molecular Weight | 215.2004 |
InChl | InChI=1/C13H9FO2/c14-12-4-2-1-3-11(12)9-5-7-10(8-6-9)13(15)16/h1-8H,(H,15,16)/p-1 |
CAS Registry Number | 365-12-8 |
EINECS | 206-671-8 |
Molecular Structure | ![]() |
Schmelzpunkt | 234℃ |
Siedepunkt | 363.9°C at 760 mmHg |
Flammpunkt | 173.9°C |
Dampfdruck | 6.2E-06mmHg at 25°C |
Gefahrensymbole | |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |