ChemIndex - 무료 화학 CAS 데이터베이스Toocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
365-12-8 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid |
|
| 상품명칭 | 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid |
| 영문 이름 | 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid;2-Fluorobiphenyl-4-carboxylic acid;bis(4-fluorophenyl)methanol;2'-fluorobiphenyl-4-carboxylate |
| 분자식 | C13H8FO2 |
| 분자량 | 215.2004 |
| InChI | InChI=1/C13H9FO2/c14-12-4-2-1-3-11(12)9-5-7-10(8-6-9)13(15)16/h1-8H,(H,15,16)/p-1 |
| cas번호 | 365-12-8 |
| EC번호 | 206-671-8 |
| 분자 구조 | ![]() |
| 녹는 점 | 234℃ |
| 비등점 | 363.9°C at 760 mmHg |
| 인화점 | 173.9°C |
| 증기압 | 6.2E-06mmHg at 25°C |
| 위험성 표시 | |
| 리스크 규칙 | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| 보안 규칙 | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |