ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
365-12-8 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid |
|
Nama produk | 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid |
Nama bahasa Inggris | 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid;2-Fluorobiphenyl-4-carboxylic acid;bis(4-fluorophenyl)methanol;2'-fluorobiphenyl-4-carboxylate |
MF | C13H8FO2 |
Berat Molekul | 215.2004 |
InChI | InChI=1/C13H9FO2/c14-12-4-2-1-3-11(12)9-5-7-10(8-6-9)13(15)16/h1-8H,(H,15,16)/p-1 |
CAS NO | 365-12-8 |
EINECS | 206-671-8 |
Struktur Molekul | ![]() |
Titik lebur | 234℃ |
Titik didih | 363.9°C at 760 mmHg |
Titik nyala | 173.9°C |
Tekanan uap | 6.2E-06mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |