Chemindex > 365-12-8
NO ▼
365-12-8 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid |
|
| produktnavn | 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid |
| Engelsk navn | 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid;2-Fluorobiphenyl-4-carboxylic acid;bis(4-fluorophenyl)methanol;2'-fluorobiphenyl-4-carboxylate |
| Molekylær Formel | C13H8FO2 |
| Molekylvekt | 215.2004 |
| InChI | InChI=1/C13H9FO2/c14-12-4-2-1-3-11(12)9-5-7-10(8-6-9)13(15)16/h1-8H,(H,15,16)/p-1 |
| CAS-nummer | 365-12-8 |
| EINECS | 206-671-8 |
| Molecular Structure | ![365-12-8 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid](https://images-a.chemnet.com/suppliers/chembase/197/19772.gif "365-12-8 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid") |
| Smeltepunkt | 234℃ |
| Kokepunkt | 363.9°C at 760 mmHg |
| Flammepunktet | 173.9°C |
| Damptrykk | 6.2E-06mmHg at 25°C |
| Hazard symboler |  Xi##Irritant:; |
| Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Hvis du planlegger å hente kjemikalier fra Kina, er det bare å gå til ChemNet kjøpesenter, vi vil få den nyeste og konkurransedyktige prisen fra kinesiske produsenter for deg.Vennligst besøk
ChemNet Mall
Kjemisk CAS-databasetjeneste leveres av ChemIndex.com 