Chemindex > 365-12-8
SA ▼
365-12-8 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid |
|
| اسم المنتج | 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid |
| الاسم بالانجليزية | 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid;2-Fluorobiphenyl-4-carboxylic acid;bis(4-fluorophenyl)methanol;2'-fluorobiphenyl-4-carboxylate |
| الصيغة الجزيئية | C13H8FO2 |
| الوزن الجزيئي الغرامي | 215.2004 |
| InChI | InChI=1/C13H9FO2/c14-12-4-2-1-3-11(12)9-5-7-10(8-6-9)13(15)16/h1-8H,(H,15,16)/p-1 |
| إستراتيجية المساعدة القطرية | 365-12-8 |
| المفوضية الأوروبية رقم | 206-671-8 |
| بنية جزيئية | ![365-12-8 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid](https://images-a.chemnet.com/suppliers/chembase/197/19772.gif "365-12-8 2'-fluoro[1,1'-biphenyl]-4-carboxylic acid") |
| درجة الإنصهار | 234℃ |
| نقطة الغليان | 363.9°C at 760 mmHg |
| نقطة الوميض | 173.9°C |
| ضغط البخار | 6.2E-06mmHg at 25°C |
| علامات على البضائع الخطرة |  Xi##Irritant:; |
| خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- إذا كنت تخطط للحصول على المواد الكيميائية من الصين ، فما عليك سوى الانتقال إلى ChemNet mall ، وسنحصل على أحدث الأسعار التنافسية من الشركات المصنعة في الصين من أجلك.يرجى زيارة
ChemNet Mall
يتم توفير خدمة قاعدة بيانات CAS الكي&# 