ChemIndex - Eine kostenlose CAS-Datenbank für ChemikalienToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5197-28-4 2-Bromo-4-nitroanisole |
|
Produkt-Name | 2-Bromo-4-nitroanisole |
Englischer Name | 2-Bromo-4-nitroanisole;Anisole, 2-bromo-4-nitro-;2-bromo-1-methoxy-4-nitrobenzene |
Molekulare Formel | C7H6BrNO3 |
Molecular Weight | 232.0314 |
InChl | InChI=1/C7H6BrNO3/c1-12-7-3-2-5(9(10)11)4-6(7)8/h2-4H,1H3 |
CAS Registry Number | 5197-28-4 |
EINECS | 225-983-5 |
Molecular Structure | ![]() |
Dichte | 1.64g/cm3 |
Schmelzpunkt | 104-106℃ |
Siedepunkt | 306.3°C at 760 mmHg |
Brechungsindex | 1.581 |
Flammpunkt | 139.1°C |
Dampfdruck | 0.00141mmHg at 25°C |
Risk Codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Safety Beschreibung | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |